| Identification |
| Name: | Antimony pentoxide |
| Synonyms: | Antimonic anhydride |
| CAS: | 1314-60-9 |
| EINECS: | 215-237-7 |
| Molecular Formula: | Sb2O5 |
| Molecular Weight: | 323.52 |
| InChI: | InChI=1/5O.2Sb/rO5Sb2/c1-6(2)5-7(3)4 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 3.78 |
| Stability: | Stable. Incompatible with acids, reducing agents. |
| Water Solubility: | slightly soluble SOLVENT |
| Solubility: | slightly soluble SOLVENT |
| Appearance: | White to yellowish powder |
| Packinggroup: | III |
| Flash Point: | °C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
