1,2,3-Propanetriol, mono(dihydrogen phosphate), manganese(2+) salt (1:1) (1320-46-3)

The Manganese glycerophosphate, with the CAS registry number 1320-46-3, is also known as 1,2,3-Propanetriol, 1-(dihydrogen phosphate), manganese(2+) salt (1:1). It belongs to the product category of Organic-metal salt. Its EINECS registry number is 215-301-4. This chemical's molecular formula is C₃H₇O₆P.Mn and molecular weight is 225.00. What's more, both its IUPAC name and systematic name are the same which is called Manganese(2+); 3-phosphonooxypropane-1,2-diolate.

Physical properties about Manganese glycerophosphate are: (1)ACD/LogP: -2.84; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -6; (4)ACD/LogD (pH 7.4): -7; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 6; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 95.03 Å²; (13)Flash Point: 247.4 °C; (14)Enthalpy of Vaporization: 86.54 kJ/mol; (15)Boiling Point: 485.5 °C at 760 mmHg; (16)Vapour Pressure: 1.83E-11 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [Mn+2].[O-]P([O-])(=O)OCC(O)CO
(2)InChI: InChI=1/C3H9O6P.Mn/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2
(3)InChIKey: CQQGLXZHXDHSJD-NUQVWONBAO