Synonyms: | 1,2,3-Propanetriol,1-(dihydrogen phosphate), sodium salt (9CI);Glycerol, 1-(dihydrogen phosphate),sodium salt (8CI);Sodium 3-phosphoglycerate;Sodium DL-glycerophosphate;Sodium glycerophosphate;Sodium a-glycerophosphate; |
Specification: |
The Sodium 3-phosphoglycerate with cas registry number of 17603-42-8, its other registry number is 35898-83-0; and its related registry number is 57-03-4 (Parent).
You can still convert the following datas into molecular structure:
(1)InChI: InChI=1/C3H9O6P.Na/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+1/p-1;
(2)Smiles: [O-]P(O)(=O)OC[C@@H](O)CO.[Na+].
The toxicity data is as follows:
Organism |
Test Type |
Route |
Reported Dose (Normalized Dose) |
Effect |
Source |
rat |
LD50 |
unreported |
3800mg/kg (3800mg/kg) |
|
German Offenlegungsschrift Patent Document. Vol. #2502735, |
|