| Identification | |
| Name: | Naphthalenol |
| Synonyms: | Naphthol(8CI); Hydroxynaphthalene; Naphthyl alcohol |
| CAS: | 1321-67-1 |
| EINECS: | 215-322-9 |
| Molecular Formula: | C10H8 O |
| Molecular Weight: | 144.172 |
| InChI: | InChI=1/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 121.6 deg C |
| Flash Point: | 144°C |
| Boiling Point: | 288°C at 760 mmHg |
| Density: | 1.181g/cm3 |
| Refractive index: | 1.677 |
| Solubility: | Soluble in alcohol, ether, chloroform, glycerol, oils, alkaline solutions. Almost insoluble in water. Very soluble in ethanol, soluble in benzene. 1 gram dissolves in 1000 ml water, 80 ml boiling water, 0.8 ml alcohol, 17 ml chloroform, 1.3 ml ether. Water solubility = 7.56X10+2 mg/L at 25 deg C. |
| Specification: |
2-Naphthol (CAS NO.1321-67-1) is a colorless crystalline solid.It is an isomer of 1-naphthol, differing by the location of the hydroxyl group on naphthalene. The naphthols are naphthalene homologues of phenol, with the hydroxyl group being more reactive than in the phenols. Both isomers are soluble in simple alcohols, ethers, and chloroform. They can be used in the production of dyes and in organic synthesis. For example, 2-Naphthol reacts to form Binol. |
| Flash Point: | 144°C |
| Color: | White, lustrious, bulky leaflets or white powder |
| Safety Data | |
 |
|
