| Identification | |
| Name: | sodium 2-methylpropanolate |
| Synonyms: | sodium 2-methylpropanolate;Sodium 2-methylpropoxide;Sodium isobutoxide |
| CAS: | 13259-29-5 |
| EINECS: | 236-254-6 |
| Molecular Formula: | C4H9NaO |
| Molecular Weight: | 96.10343 |
| InChI: | InChI=1/C4H9O.Na/c1-4(2)3-5;/h4H,3H2,1-2H3;/q-1;+1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -108 deg C |
| Flash Point: | 27.8°C |
| Boiling Point: | 105°C at 760 mmHg |
| Solubility: | 10% in water @ 20 deg C, 10% in acetone, 10% in ether, 10% in alcohol. Miscible with alcohol and ether In water, 8.5X10+4 mg/l @ 25 deg C [Valvani SC et al; J Pharm Sci 70: 502-7 (1981)] PubMed Abstract |
| Flash Point: | 27.8°C |
| Color: | Colorless, oily liquid Clear, colorless, refractive, mobile liquid. |
| Safety Data | |
 |
|
