| Identification | |
| Name: | Sodium 2-phenylcinchoninate |
| Synonyms: | sodium 2-phenylquinoline-4-carboxylate |
| CAS: | 5949-18-8 |
| EINECS: | 227-710-5 |
| Molecular Formula: | C16H11NO2 . Na |
| Molecular Weight: | 271.2459 |
| InChI: | InChI=1/C16H11NO2.Na/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H,18,19);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 230.1°C |
| Boiling Point: | 456.9°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Sodium 2-phenylcinchoninate with cas registry number of 5949-18-8 is also known as Cinchophen sodium salt ; Atophan sodium ; Atophan-natrium ; Cinchophen sodium ; Cinchophen, sodium salt ; Sodium 2-phenyl-4-quinolinecarboxylate ; Sodium cinchophen ; 4-Quinolinecarboxylic acid, 2-phenyl-, sodium salt (9CI) ; Cinchoninic acid, 2-phenyl-, sodium salt ; Cinchophen sodium . Sodium 2-phenylcinchoninate with cas registry number of 5949-18-8 is used as an intermediate in synthesis of many valuable compounds. |
| Flash Point: | 230.1°C |
| Safety Data | |
 |
|
