| Identification | |
| Name: | Cyclohexanone, methyl- |
| Synonyms: | Methylcyclohexan-1-one;Methylcyclohexanone |
| CAS: | 1331-22-2 |
| EINECS: | 215-556-1 |
| Molecular Formula: | C7H12 O |
| Molecular Weight: | 112.19 |
| InChI: | InChI=1/C7H12O/c1-6-4-2-3-5-7(6)8/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2297 3/PG 3 |
| Flash Point: | 45.9°C |
| Boiling Point: | 163.7°Cat760mmHg |
| Density: | 0.912g/cm3 |
| Refractive index: | n20/D 1.446 |
| Specification: |
Methylcyclohexanone (CAS NO.1331-22-2) is also called Metylocykloheksanon ; Metylocykloheksanon [Polish] ; Cyclohexanone, methyl- . Methylcyclohexanone (CAS NO.1331-22-2) is high toxic. It is flammable by fire, high temperature and strong oxidant. It will emit stimulation moke when buring. So the storage environment should be ventilate, low-temperature and dry. Keep Methylcyclohexanone (CAS NO.1331-22-2) separate from fire, high temperature and strong oxidant. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 45.9°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
