| Identification | |
| Name: | Propanoic acid,3-(methylthio)-, ethyl ester |
| Synonyms: | Propionicacid, 3-(methylthio)-, ethyl ester (6CI,7CI,8CI);3-(Methylthio)-propanoic acidethyl ester;3-(Methylthio)propionic acid ethyl ester;Ethyl b-methylthiopropionate;NSC 165650; |
| CAS: | 13327-56-5 |
| EINECS: | 236-370-7 |
| Molecular Formula: | C6H12O2S |
| Molecular Weight: | 148.22 |
| InChI: | InChI=1/C6H12O2S/c1-3-8-6(7)4-5-9-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177 oF |
| Density: | 1.03 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.459-1.461 |
| Appearance: | COLORLESS TO PALE YELLOW LIQUID |
| Specification: |
?Propanoic acid,3-(methylthio)-, ethyl ester , its cas register number is 13327-56-5. It also can be called?3-(Methylthio)propionic acid ethylester ; Ethyl 3-(methylthio)propanoate ; Ethyl 3-(methylthio)propionate ; Ethyl 3-methylmercaptopropionate ; Ethyl beta-methylthiopropionate ; Ethyl methyl mercaptopropionate .It is a?clear colorless to pale yellow liquid?with a stench. |
| Flash Point: | 177 oF |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
