| Identification | |
| Name: | Propanoic acid,3-(methylthio)-, methyl ester |
| Synonyms: | Propionicacid, 3-(methylthio)-, methyl ester (6CI,7CI,8CI);2-Methoxycarbonylethylmethyl sulfide;Methyl 3-(methylthio)propionate;Methyl b-methylthiopropionate;NSC 76415; |
| CAS: | 13532-18-8 |
| EINECS: | 236-883-6 |
| Molecular Formula: | C5H10O2S |
| Molecular Weight: | 134.19 |
| InChI: | InChI=1/C5H10O2S/c1-7-5(6)3-4-8-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.07 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.464-1.466 |
| Solubility: | Insoluble |
| Appearance: | colourless to pale yellow liquid with onion-like odour |
| Specification: |
Propanoic acid,3-(methylthio)-, methyl ester , its cas register number is 13532-18-8. It also can be called Methyl 3-(methylthio)propanoate ; Methyl 3-methylthiopropionate ; Methyl beta-methiopropionate ; Methyl beta-methylmercaptopropionate ; Methyl beta-methylthiopropionate .It is a clear, colorless liquid with a stench. |
| HS Code: | 29309070 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
