| Identification | |
| Name: | 3-Piperidinol, 1-ethyl- |
| Synonyms: | 1-Ethyl-3-piperidinol;3-Hydroxy-1-ethylpiperidine;N-Ethyl-3-hydroxypiperidine;N-Ethyl-3-piperidinol; |
| CAS: | 13444-24-1 |
| EINECS: | 236-584-0 |
| Molecular Formula: | C7H15NO |
| Molecular Weight: | 129.2 |
| InChI: | InChI=1/C7H15NO/c1-2-8-5-3-4-7(9)6-8/h7,9H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3 |
| Density: | 0.97 |
| Refractive index: | 1.4754-1.4774 |
| Water Solubility: | very soluble in water |
| Solubility: | very soluble in water |
| Appearance: | Light yellow liquid. |
| Specification: |
3-Piperidinol, 1-ethyl- , its cas register number is 13444-24-1. It also can be called 1-Ethyl-3-piperidinol ; AI3-27593 ; 1-Ethylpiperidin-3-ol . 3-Piperidinol, 1-ethyl- (CAS NO.13444-24-1) is irritating to eyes, respiratory system and skin, and it is also harmful if swallowed. And it is flammable. After contact with skin, you should wash immediately with plenty of soap-suds. And be sure ti keep it away from sources of ignition. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
