| Identification | |
| Name: | 3,4,5-Trihydroxybenzaldehyde |
| Synonyms: | Gallaldehyde(7CI,8CI);Benzaldehyde,3,4,5-trihydroxy-;NSC 153692; |
| CAS: | 13677-79-7 |
| EINECS: | 237-168-1 |
| Molecular Formula: | C7H6O4 |
| Molecular Weight: | 154.12 |
| InChI: | InChI=1/C7H6O4/c8-3-4-1-5(9)7(11)6(10)2-4/h1-3,9-11H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.598 g/cm3 |
| Refractive index: | 1.734 |
| Appearance: | colorless and transparent liquid |
| Specification: |
3,4,5-Trihydroxybenzaldehyde (CAS NO.13677-79-7), its cas register number is 13677-79-7. It also can be called Benzaldehyde,3,4,5-trihydroxy- ; Gallaldehyde . |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
