| Identification |
| Name: | 2,3,4-Trihydroxybenzaldehyde |
| Synonyms: | Pyrogallolaldehyde;2,3,4-Trihydroxy-benzaldehyd; Benzaldehyde,2,3,4-trihydroxy; protocataculaldehyde; EINECS 218-404-2; Pyrogallol-4-carboxaldehyde;
2,3,4-trihydroxy benzaldehyde; 2,3,4-trishydroxybenzaldehyde; 2,3,4,5,6-PENTAFLUOROPHENYL 4-BROMO-2-CHLOROBENZENESULPHONATE; |
| CAS: | 2144-08-3 |
| EINECS: | 218-404-2 |
| Molecular Formula: | C7H6O4 |
| Molecular Weight: | 154.12 |
| InChI: | InChI=1/C7H6O4/c8-3-4-1-2-5(9)7(11)6(4)10/h1-3,9-11H |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 1.598 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.734???? |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 2912499000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
