| Identification | |
| Name: | 1-bromo-3,4,5-trifluorobenzene |
| Synonyms: | 5-Bromo-1,2,3-trifluorobenzene; 3,4,5-trifluorobromobenzene |
| CAS: | 138526-69-9 |
| EINECS: | 418-480-9 |
| Molecular Formula: | C6H2BrF3 |
| Molecular Weight: | 210.98 |
| InChI: | InChI:1S/C6H2BrF3/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | <-20 oC |
| Density: | 1.767 |
| Refractive index: | 1.481-1.483 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Colorless to yellowish liquid. |
| Specification: |
? 1-Bromo-3,4,5-trifluorobenzene (CAS NO.138526-69-9), its Synonyms are 3,4,5-Trifluoro-1-bromobenzene ; 3,4,5-Ttrifluorobromobenzene ; 5-Bromo-1,2,3-trifluorobenzene ; 1,2,3-Trifluoro-5-bromobenzene ; Benzene, 5-bromo-1,2,3-trifluoro- . It is clear slightly yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Flammables area |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
