| Identification | |
| Name: | 1-Bromo-2,4,5-trifluorobenzene |
| Synonyms: | 2,4,5-TRIFLUOROBENZOBROMIDE; 2,4,5-trifluorobromobenzene; m-fluorophenol |
| CAS: | 327-52-6 |
| EINECS: | 206-318-8 |
| Molecular Formula: | C6H2BrF3 |
| Molecular Weight: | 210.98 |
| InChI: | InChI=1/C6H2BrF3/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.806 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.485-1.487 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear slightly yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
