| Identification | |
| Name: | Benzene,1,1'-methylenebis[4-isocyanato-3-methyl- |
| Synonyms: | Isocyanicacid, methylenebis(2-methyl-p-phenylene) ester (7CI,8CI);3,3'-Dimethyldiphenylmethane 4,4'-diisocyanate;4,4'-Diisocyanato-3,3'-dimethyldiphenylmethane;4,4'-Diphenyl-3,3'-dimethylmethane diisocyanate; NSC 84203; Nacconate 310 |
| CAS: | 139-25-3 |
| Molecular Formula: | C17H14 N2 O2 |
| Molecular Weight: | 278.33 |
| InChI: | InChI=1/C17H14N2O2/c1-12-7-14(3-5-16(12)18-10-20)9-15-4-6-17(19-11-21)13(2)8-15/h3-8H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.1 g/cm3 |
| Refractive index: | 1.576 |
| Specification: |
Reactivity Profile: Isocyanates and thioisocyanates, such as 4, 4'-Diisocyanato-3,3'-dimethyldiphenylmethane (CAS NO. 139-25-3) , are incompatible with many classes of compounds, reacting exothermically to release toxic gases. Reactions with amines, aldehydes, alcohols, alkali metals, ketones, mercaptans, strong oxidizers, hydrides, phenols, and peroxides can cause vigorous releases of heat. Acids and bases initiate polymerization reactions in these materials. Some isocyanates react with water to form amines and liberate carbon dioxide. Base-catalysed reactions of isocyanates with alcohols should be carried out in inert solvents. Such reactions in the absence of solvents often occur with explosive violence. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
