| Identification | |
| Name: | 4-Quinolinamine,6-chloro-N-hydroxy-, 1-oxide |
| Synonyms: | Quinoline,6-chloro-4-(hydroxyamino)-, 1-oxide (8CI) |
| CAS: | 14076-05-2 |
| Molecular Formula: | C9H7 Cl N2 O2 |
| Molecular Weight: | 210.63 |
| InChI: | InChI=1/C9H7ClN2O2/c10-6-1-2-9-7(5-6)8(11-13)3-4-12(9)14/h1-5,13-14H/b11-8+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 194.8°C |
| Boiling Point: | 398.5°Cat760mmHg |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
6-Chloro-4-(hydroxyamino)quinoline 1-oxide , its cas register number is 14076-05-2. It also can be called 5-22-14-00475 (Beilstein Handbook Reference) ; BRN 0396157 . When 6-Chloro-4-(hydroxyamino)quinoline 1-oxide (CAS NO.14076-05-2) is heated to decomposition, it emits very toxic fumes of Cl− and NOx. |
| Flash Point: | 194.8°C |
| Safety Data | |
 |
|
