| Identification | |
| Name: | 4-Quinolinamine,6-butyl-N-hydroxy-, 1-oxide |
| Synonyms: | Quinoline,6-butyl-4-(hydroxyamino)-, 1-oxide (8CI) |
| CAS: | 21070-33-7 |
| Molecular Formula: | C13H16 N2 O2 |
| Molecular Weight: | 232.31 |
| InChI: | InChI=1/C13H16N2O2/c1-2-3-4-10-5-6-13-11(9-10)12(14-16)7-8-15(13)17/h5-9,16-17H,2-4H2,1H3/b14-12+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 198.6°C |
| Boiling Point: | 404.8°Cat760mmHg |
| Density: | 1.19g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
6-Butyl-4-hydroxyaminoquinoline-1-oxide , its cas register number is 21070-33-7. It also can be called 5-22-14-00477 (Beilstein Handbook Reference) ; BRN 0401631 . When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 198.6°C |
| Safety Data | |
 |
|
