| Identification | |
| Name: | (S)-(+)-2-Chlorophenylglycine methyl ester |
| Synonyms: | Benzeneaceticacid, a-amino-2-chloro-, methyl ester,(+)-;Benzeneacetic acid, a-amino-2-chloro-, methyl ester, (aS)-;(S)-Methyl 2-(o-chlorophenyl)glycinate;Methyl(2S)-(+)-amino(2-chlorophenyl)acetate; |
| CAS: | 141109-14-0 |
| Molecular Formula: | C9H10ClNO2 |
| Molecular Weight: | 199.63 |
| InChI: | InChI=1/C9H10ClNO2.ClH/c1-13-9(12)6-11-8-5-3-2-4-7(8)10;/h2-5,11H,6H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 117.2 °C |
| Boiling Point: | 270.1 °C at 760 mmHg |
| Density: | 1.258 g/cm3 |
| Appearance: | light yellow to yellow liquid |
| Specification: |
?(S)-(+)-2-Chlorophenylglycine methyl ester , its cas register number 141109-14-0. It also can be called?Benzeneacetic acid, alpha-amino-2-chloro-, methyl ester, (alphaS)-?; Methyl (2S)-amino(2-chlorophenyl)acetate ; and Methyl (2S)-amino(2-chlorophenyl)ethanoate . |
| Flash Point: | 117.2 °C |
| Safety Data | |
 |
|
