| Identification | |
| Name: | Allyl heptylate |
| Synonyms: | ALLYL HEPTANOATE |
| CAS: | 142-19-8 |
| EINECS: | 205-527-1 |
| Molecular Formula: | C10H18O2 |
| Molecular Weight: | 170.25 |
| InChI: | InChI=1/C10H18O2/c1-3-5-6-7-8-10(11)12-9-4-2/h4H,2-3,5-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 0.882 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4275-1.4295 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | Clear, colorless liquid. Strong, sweet-fruity, like pineapple odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
