| Identification | |
| Name: | Piperazine adipate |
| Synonyms: | Hexanedioic acid,compounds,compd. with piperazine (1:1);Adipic acid, compd. with piperazine (1:1);Nometan;Pipadox;Oxypaat;Arduvermin;Adiprazine;Camin AP (TN);Camin AP;Piperascat;Piperazine adipinate;Vermicompren;Piperazine adipate (JP14);Helmirazin;Hexanedioic acid, compd. with piperazine (1:1);Adiprazina;Vermilass;hexanedioic acid; piperazine;Entacyl;Oxurasin;Dietelmin;Piperaskat;Divermex; |
| CAS: | 142-88-1 |
| EINECS: | 205-622-8 |
| Molecular Formula: | C10H20N2O4 |
| Molecular Weight: | 232.2768 |
| InChI: | InChI=1S/C6H10O4.C4H10N2/c7-5(8)3-1-2-4-6(9)10;1-2-6-4-3-5-1/h1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 250 C (Decomposes) |
| Flash Point: | 172.7ºC |
| Boiling Point: | 338.5 ºC at 760 mmHg |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. May be light-sensitive. |
| Water Solubility: | Soluble |
| Solubility: | Soluble Appearance:White crystalline powder Transport Information:25kgs Hazard Symbols:UN NO. particular:particular |
| Appearance: | White crystalline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 172.7ºC |
| Safety Data | |
| Hazard Symbols | |
 |
|
