| Identification | |
| Name: | Lauric acid |
| Synonyms: | Dodecanoic acid; lauric acid free acid sigma grade; lauric acid, pure; Lauric acid 98-101 % (acidimetric) |
| CAS: | 143-07-7 |
| EINECS: | 205-582-1 |
| Molecular Formula: | C12H24O2 |
| Molecular Weight: | 200.32 |
| InChI: | InChI=1/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 0.883 |
| Stability: | Stable. Combustible. Incompatible with bases, oxidizing agents, reducing agents. |
| Refractive index: | 1.4304 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear liquid |
| HS Code: | 29159010 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless needles Needles from alcohol White, crystalline powder |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
