| Identification | |
| Name: | NONYL ACETATE |
| Synonyms: | 1-acetoxynonane;1-nonylacetate;Aceticacid,nonylester;aceticacidnonylester;n-Nonanyl acetate;n-nonanylacetate;n-Nonyl ethanoate;n-nonylethanoate |
| CAS: | 143-13-5 |
| EINECS: | 205-585-8 |
| Molecular Formula: | C11H22O2 |
| Molecular Weight: | 186.29 |
| InChI: | InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-13-11(2)12/h3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.424(lit.) |
| Specification: |
Nonanyl acetate ,its cas register number is 143-13-5. It also can be called Acetic acid, nonyl ester ; and n-Nonyl acetate .It is an ester. Esters react with acids to liberate heat along with alcohols and acids. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. |
| Packinggroup: | Z01 |
| Safety Data | |
 |
|
