| Identification | |
| Name: | D-(+)-Glucose monohydrate |
| Synonyms: | a-D-Glucopyranose, monohydrate(9CI);a-D-Glucose monohydrate;a-D-Glucopyranose, hydrate (1:1);Dextrose; |
| CAS: | 14431-43-7 |
| EINECS: | 200-075-1 |
| Molecular Formula: | C6H12O6.H2O |
| Molecular Weight: | 180.15588 |
| InChI: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.581 g/cm3 |
| Water Solubility: | Water solubility: 1 M, clear, colorless |
| Solubility: | Water solubility: 1 M, clear, colorless |
| Specification: |
D-(+)-Glucose monohydrate , its cas register number is 14431-43-7. It also can be called Dextrose ; Glucose ; and D-(+)-Glucopyranose monohydrate . |
| Color: | Colorless crystals or white granular powder |
| Safety Data | |
 |
|
