| Identification | |
| Name: | Benzenepropanoic acid, a,4-dichloro-, methyl ester |
| Synonyms: | Hydrocinnamicacid, p,a-dichloro-, methyl ester (8CI);2-Chloro-3-(4-chlorophenyl)propionic acid methyl ester; B 57-10; BAY 70533;Bayer 70533; Bidisin; Bidisin F; Bidisin Forte; Chlorfenprop-methyl;Chlorphenprop-methyl; Fatex; Methachlorphenprop; Methyl2-chloro-3-(4-chlorophenyl)propionate; Methyl2-chloro-3-(p-chlorophenyl)propionate; Methyl 3-(4-chlorophenyl)-2-chloropropionate;Methyl 3-(p-chlorophenyl)-2-chloropropionate; Methyl a-chloro-b-(p-chlorophenyl)propionate |
| CAS: | 14437-17-3 |
| EINECS: | 238-413-5 |
| Molecular Formula: | C10H10 Cl2 O2 |
| Molecular Weight: | 233.10 |
| InChI: | InChI=1S/C10H10Cl2O2/c1-14-10(13)9(12)6-7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 6.1/PG 3 |
| Flash Point: | 121.9°C |
| Boiling Point: | 300.4°Cat760mmHg |
| Density: | 1.277g/cm3 |
| Refractive index: | 1.532 |
| Specification: |
Chlorfenprop-methyl ,its cas register number is 14437-17-3. It also can be called Propionic acid, 2-chloro-3-(4-chlorophenyl)-, methyl ester ; Bidisin ; and Methyl-2-chloro-3-(4-chlorophenyl)propionate . |
| Flash Point: | 121.9°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
