| Identification | |
| Name: | 1-Methyl-4-piperidone |
| Synonyms: | 4-Piperidone,1-methyl- (6CI,7CI,8CI);1-Methyl-4-oxopiperidine;N-Methyl-4-piperidinone;NSC66491;4-Piperidinone,1-methyl-;N-Methyl-4-piperidone; |
| CAS: | 1445-73-4 |
| EINECS: | 215-895-5 |
| Molecular Formula: | C6H11NO |
| Molecular Weight: | 113.16 |
| InChI: | InChI=1/C6H11NO/c1-7-4-2-6(8)3-5-7/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.46-1.462 |
| Water Solubility: | MISCIBLE |
| Solubility: | Miscible |
| Appearance: | clear yellow to orange liquid |
| Specification: |
?N-Methyl-4-piperidone (CAS NO.1445-73-4), its Synonyms are 4-Piperidinone,1-methyl- ; 1-Methyltetrahydropyridin-4(1H)-one- ; N-Methyl-4-piperidone ; 4-Piperidone,1-methyl- (6CI,7CI,8CI) . |
| Packinggroup: | III |
| HS Code: | 29333999 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
