| Identification |
| Name: | 1-Ethyl-4-piperidone |
| Synonyms: | 1-ethylpiperidin-4-one; N-Ethyl-4-Piperidone |
| CAS: | 3612-18-8 |
| EINECS: | 222-781-9 |
| Molecular Formula: | C7H13NO |
| Molecular Weight: | 127.18 |
| InChI: | InChI=1/C7H13NO/c1-2-8-5-3-7(9)4-6-8/h2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Melting Point: | 30-32C |
| Density: | 0.939 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.462-1.466 |
| Water Solubility: | Miscible |
| Solubility: | Miscible |
| Appearance: | clear to yellowish liquid |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
