| Identification | |
| Name: | Cerussite (Pb(CO3))(9CI) |
| Synonyms: | Cerussite(8CI) |
| CAS: | 14476-15-4 |
| Molecular Formula: | CH2 O3 . Pb |
| Molecular Weight: | 267.2089 |
| InChI: | InChI=1S/CH2O3.Pb/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 315 deg C, decomposes |
| Solubility: | Sol in acids and alkalies; insoluble in alcohol and ammonia In water, 0.00011 g/100 mL at 20 deg C |
| Color: | Colorless, rhombic crystals |
| Safety Data | |
 |
|
