Identification |
Name: | Cerussite (Pb(CO3))(9CI) |
Synonyms: | Cerussite(8CI) |
CAS: | 14476-15-4 |
Molecular Formula: | CH2 O3 . Pb |
Molecular Weight: | 267.2089 |
InChI: | InChI=1S/CH2O3.Pb/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 315 deg C, decomposes |
Solubility: | Sol in acids and alkalies; insoluble in alcohol and ammonia In water, 0.00011 g/100 mL at 20 deg C |
Color: | Colorless, rhombic crystals |
Safety Data |
|
 |