| Identification | |
| Name: | Selegiline hydrochloride |
| Synonyms: | Benzeneethanamine, N,a-dimethyl-N-2-propynyl-, hydrochloride, (aR)- (9CI);(-)-Deprenyl hydrochloride;Eldeprine;Eldepryl;Jumex;Movergan;Plurimen;l-Deprenyl hydrochloride;Selegiline HCl; |
| CAS: | 14611-52-0 |
| Molecular Formula: | C13H18ClN |
| Molecular Weight: | 223.74172 |
| InChI: | InChI=1S/C13H17N.ClH/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h1,5-9,12H,10-11H2,2-3H3;1H/t12-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Density: | 0.954g/cm3 |
| Water Solubility: | H2O: >10 mg/mL |
| Solubility: | H2O: >10 mg/mL |
| Appearance: | white Crystalline Solid |
| Specification: |
Selegiline hydrochloride , with CAS number of 14611-52-0, can be called Benzeneethanamine,N,a-dimethyl-N-2-propynyl-,hydrochloride, (R)- ; Benzeneethanamine, N,a-dimethyl-N-2-propynyl-, hydrochloride, (aR)- (9CI) ; (-)-Deprenilhydrochloride ; (-)-Deprenyl hydrochloride ; l-Deprenyl hydrochloride ; Selegilinehydrochloride ; R-Selegiline hydrochloride. |
| Packinggroup: | III |
| Biological Activity: | Selective inhibitor of monoamine oxidase B (MAO-B). |
| Color: | white |
| Usage: |
Selegiline hydrochloride (CAS NO.14611-52-0) is used in newly diagnosed patients with Parkinson's disease. |
| Safety Data | |
 |
|
