| Identification | |
| Name: | 3-Acetylthiophene |
| Synonyms: | Methyl 3-thienyl ketone; Acetylthiophene,97%; Acetylthiophene,95%; 3-Ethylthiophene; 3-Acetothienone; Acetylthiophene; 3-Acetyl thiophene |
| CAS: | 1468-83-3 |
| EINECS: | 215-996-4 |
| Molecular Formula: | C6H6OS |
| Molecular Weight: | 126.17 |
| InChI: | InChI=1/C6H6OS/c1-5(7)6-2-3-8-4-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Density: | 1.142 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54 |
| Solubility: | Slightly soluble |
| Appearance: | white to light yellow crystal powder |
| Specification: |
? 3-Acetylthiophene ,?its cas register number is 1468-83-3. It also can be called? Ethanone, 1-(3-thienyl)- ; Methyl 3-thienyl ketone ;?3-Acetyl Thiophene ;?3-Acetyl Benzothiophen . |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
