| Identification |
| Name: | 2-Acetylthiophene |
| Synonyms: | 2-Acetyl thiophene; Methyl 2-thienyl ketone |
| CAS: | 88-15-3 |
| EINECS: | 201-804-6 |
| Molecular Formula: | C6H6OS |
| Molecular Weight: | 126.17 |
| InChI: | InChI=1/C6H6OS/c1-5(7)6-3-2-4-8-6/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 50kgs |
| Density: | 1.16 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.564-1.568 |
| Water Solubility: | Slightly soluble SOLVENT |
| Solubility: | Slightly soluble SOLVENT |
| Appearance: | yellow to brown liquid |
| Packinggroup: | II |
| HS Code: | 29349990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
