| Identification |
| Name: | L-Lysine,N6-(aminoiminomethyl)-, hydrochloride (1:1) |
| CAS: | 1483-01-8 |
| EINECS: | 216-045-6 |
| Molecular Formula: | C7H16N4O2.HCl |
| Molecular Weight: | 224.69 |
| InChI: | InChI=1/C7H16N4O2.ClH/c8-5(6(12)13)3-1-2-4-11-7(9)10;/h5H,1-4,8H2,(H,12,13)(H4,9,10,11);1H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.39 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 18 º (C=1, 1N HCL) |
| Solubility: | water: 50 mg/mL |
| Appearance: | White powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | An inhibitor of alkaline phosphatase isoenzymes |
| Safety Data |
| |
 |
