| Identification | |
| Name: | L-Lysine,N6-(1-oxododecyl)- |
| Synonyms: | Lysine,N6-lauroyl-, L- (6CI); Amihope LL; Famex L 12; N-Lauroyl-L-lysine;N6-Lauroyl-L-lysine; Ne-Lauroyl-L-lysine; Ne-Lauroyllysine; Ne-Lauroyllysine; Ne-Lauryl-L-lysine |
| CAS: | 52315-75-0 |
| EINECS: | 257-843-4 |
| Molecular Formula: | C18H36 N2 O3 |
| Molecular Weight: | 328.49 |
| InChI: | InChI=1/C18H36N2O3/c1-2-3-4-5-6-7-8-9-10-14-17(21)20-15-12-11-13-16(19)18(22)23/h16H,2-15,19H2,1H3,(H,20,21)(H,22,23)/t16-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 229-231 ºC |
| Density: | 0.994 g/cm3 |
| Refractive index: | 1.481 |
| Appearance: | White to off-white solid with characteristic faint odor |
| Specification: |
The N'-Laruoyl-L-lysine with the cas number 52315-75-0 is also called N6-(1-Oxododecyl)-L-lysine. The IUPAC name is (2S)-2-amino-6-(dodecanoylamino)hexanoic acid. Its EINECS registry number is 257-843-4. The molecular formula of this chemical is C18H36N2O3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 3.89; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.39; (4)ACD/LogD (pH 7.4): 1.39; (5)ACD/BCF (pH 5.5): 1.69; (6)ACD/BCF (pH 7.4): 1.68; (7)ACD/KOC (pH 5.5): 9.86; (8)ACD/KOC (pH 7.4): 9.83; (9)#H bond acceptors: 5; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 17; (12)Polar Surface Area: 49.85Å2; (13)Index of Refraction: 1.481; (14)Molar Refractivity: 94.12 cm3; (15)Molar Volume: 330.2 cm3; (16)Polarizability: 37.31×10-24cm3; (17)Surface Tension: 39.7 dyne/cm; (18)Enthalpy of Vaporization: 87.81 kJ/mol; (19)Vapour Pressure: 1.48×10-12 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
