| Identification | |
| Name: | 1,3-Benzodioxole-5-ethanamine |
| Synonyms: | Phenethylamine,3,4-(methylenedioxy)- (7CI,8CI);2-(3,4-Methylenedioxyphenyl)ethylamine;2-(Benzo[d][1,3]dioxol-5-yl)ethanamine;2-Benzo[1,3]dioxol-5-yl-ethylamine;2-Benzo[1,3]dioxol-5-ylethanamine;3,4-(Methylenedioxy)-b-phenethylamine;3,4-(Methylenedioxy)phenethylamine;3,4-(Methylenedioxy)phenylethylamine;5-(2-Aminoethyl)benzodioxole;Homopiperonylamine;[2-(Benzodioxol-5-yl)ethyl]amine; |
| CAS: | 1484-85-1 |
| EINECS: | 216-060-8 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.19 |
| InChI: | InChI=1/C10H13NO3/c1-12-8-4-7(2-3-11)5-9-10(8)14-6-13-9/h4-5H,2-3,6,11H2,1H3 |
| Molecular Structure: | ![(C9H11NO2) Phenethylamine,3,4-(methylenedioxy)- (7CI,8CI);2-(3,4-Methylenedioxyphenyl)ethylamine;2-(Benzo[d][1,...](https://img1.guidechem.com/chem/e/dict/45/1484-85-1.jpg) |
| Properties | |
| Flash Point: | 129.8 ºC |
| Boiling Point: | 274.3 ºCat 760 mmHg |
| Density: | 1.204 g/c3 |
| Refractive index: | 1.561 |
| Appearance: | Colourless Liquid |
| Specification: |
1,3-Benzodioxole-5-ethanamine (CAS NO.1484-85-1) is called as 2-(3,4-(Methylendioxy)phenyl)ethylamine ; 2-(3',4'-Methylenedioxy-phenyl)ethylamine ; 3,4-mde ; 3,4-Methylenedioxyphenethylamine ; 3,4-(Methylenedioxyphenyl)ethylamine ; Dl-mdea ; Homopiperonylamine . |
| Flash Point: | 129.8 ºC |
| Usage: |
1,3-Benzodioxole-5-ethanamine (CAS NO.1484-85-1) is used as an intermediate in the synthesis of pharmaceutical actives and other fine chemicals. |
| Safety Data | |
 |
|
