| Identification | |
| Name: | Trimethyl orthoformate |
| Synonyms: | Methyl orthoformate; Orthoformic acid trimethyl ester; Thrimethyl orthoformate; Trimethoxymethane |
| CAS: | 149-73-5 |
| EINECS: | 205-745-7 |
| Molecular Formula: | C4H10O3 |
| Molecular Weight: | 106.12 |
| InChI: | InChI=1/C4H10O3/c1-5-4(6-2)7-3/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 3 |
| Density: | 0.97 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.378-1.38 |
| Water Solubility: | 10 g/L (hydrolysis) |
| Solubility: | 10 g/L (hydrolysis) in water Soluble in methanol, chloroform |
| Appearance: | Colorless transparent liquid |
| Specification: |
Fire Fighting:Wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. Will burn if involved in a fire. Use water spray to keep fire-exposed containers cool. Containers may explode in the heat of a fire. Extinguishing media: For small fires, use dry chemical, carbon dioxide, water spray or alcohol-resistant foam. For large fires, use water spray, fog, or alcohol-resistant foam. Do NOT use water directly on fire. Use water spray to cool fire-exposed containers. Water may be ineffective. Do NOT use straight streams of water. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
