| Identification | |
| Name: | Trimethyl borate |
| Synonyms: | Methyl borate; Trimethyl borate (Boron methoxide); Trimethyl borate, (Boric acid trimethyl ester; Boronmethoxideinmethanol; Boric acid trimethyl ester; Boron methoxide |
| CAS: | 121-43-7 |
| EINECS: | 204-468-9 |
| Molecular Formula: | C3H9BO3 |
| Molecular Weight: | 103.91 |
| InChI: | InChI=1/C3H9BO3/c1-5-4(6-2)7-3/h1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2416 |
| Density: | 0.932 |
| Stability: | Stable. Incompatible with oxidizing agents. Decomposes slowly in the presence of moisture, rapidly in water. Flammable. |
| Refractive index: | 1.3562-1.3582 |
| Water Solubility: | reacts |
| Solubility: | Decomposes |
| Appearance: | A water-white liquid |
| Specification: |
?Trimethyl borate , its cas register number is 121-43-7. It also can be called Boric acid trimethyl ester ; Methyl borate ; and Boron methoxide . |
| Packinggroup: | II |
| HS Code: | 29209085 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Color: | Colorless, moisture-sensitive liquid; fumes in air |
| Usage: | As solvent for waxes, resins, oils, catalyst in manufacture of ketones, analysis of paintermediate & varnish ingredients, as neutron detector gas in presence of a scintillation counter, as promotor of diborane reactions. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
