| Identification | |
| Name: | Tributyl borate |
| Synonyms: | Tributoxyborane; Tri-n-butyl borate; Trinbutylboratecolorlessliq; Boric acid tri-n-butyl ester~n-Butyl borate; Boron n-butoxide |
| CAS: | 688-74-4 |
| EINECS: | 211-706-5 |
| Molecular Formula: | C12H27BO3 |
| Molecular Weight: | 230.15 |
| InChI: | InChI=1/C12H27BO3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h4-12H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 170kgs |
| Density: | 0.853 |
| Stability: | Stables, but reacts rapidly with moisture, water. Reacts vigorously with oxidizing agents. Incompatible with strong acids. |
| Refractive index: | 1.408-1.41 |
| Water Solubility: | decomposes |
| Solubility: | Decomposes |
| Appearance: | clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Keep under a nitrogen blanket. |
| Sensitive: | Moisture Sensitive |
| Color: | Water-white liquid Colorless, mobile, moisture sensitive liquid |
| Usage: | Welding fluxes, intermediate in preparation of borohydrides, flame retardant for textiles (with boric acid). |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
