| Identification |
| Name: | Triisopropyl borate |
| Synonyms: | Triisopropoxyborane; Triisopropyl borate, (Boric acid triisopropyl ester; Isop; Triisorpopyl borate; Boron Isopropoxide; Boric acid triisopropyl ester~Isopropyl borate; Triisopropylborane; Tri-i-propylborate |
| CAS: | 5419-55-6 |
| EINECS: | 226-529-9 |
| Molecular Formula: | C9H21BO3 |
| Molecular Weight: | 188.07 |
| InChI: | InChI=1/C9H21BO3/c1-7(2)11-10(12-8(3)4)13-9(5)6/h7-9H,1-6H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2616 |
| Density: | 0.814 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | 1.3755-1.3775 |
| Water Solubility: | decomposes |
| Solubility: | Decomposes |
| Appearance: | clear liquid |
| Packinggroup: | II |
| HS Code: | 29209085 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
