| Identification | |
| Name: | 9,12-Octadecadienoicacid (9Z,12Z)-, ion(1-) |
| Synonyms: | 9,12-Octadecadienoicacid (Z,Z)-, ion(1-); Linoleic acid, ion(1-) (8CI); Linoleate |
| CAS: | 1509-85-9 |
| Molecular Formula: | C18H31 O2 |
| Molecular Weight: | 279.4381 |
| InChI: | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9- |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -8.5 deg C |
| Flash Point: | 273°C |
| Boiling Point: | 360.6°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Freely sol in ether; sol in absolute alcohol; 1 ml dissolves in 10 ml petroleum ether; miscible with dimethylformamide, fat solvents, oils Very soluble in acetone, benzene, ethyl ether, and ethanol. In acetone: 4.10 g/100 g acetone at -50 deg C, 1.20 g/100 g acetone at -60 deg C, 0.35 g/100 g acetone at -70 deg C; in n-heptane: 0.98 g/100 g n-heptane at -50 deg C, 0.20 g/100 g n-heptane at -60 deg C, 0.042 g/100 g n-heptane at -70 deg C. In water, 0.139 mg/L at 25 deg C (est) |
| Flash Point: | 273°C |
| Color: | Colorless oil Colorless to straw-colored liquid |
| Safety Data | |
 |
|
