Identification |
Name: | 9,12-Octadecadienoicacid (9Z,12Z)- |
Synonyms: | 9,12-Octadecadienoicacid (Z,Z)-;Linoleic acid (8CI);(9Z,12Z)-9,12-Octadecadienoic acid;(Z,Z)-9,12-Octadecadienoic acid;9,12-Octadecadienoic acid, (Z,Z)-;9-cis,12-cis-Linoleic acid;9Z,12Z-Linoleic acid;9Z,12Z-Octadecadienoic acid;Emersol 315;Extra Linoleic 90;all-cis-9,12-Octadecadienoic acid;cis,cis-Linoleic acid;cis-9,cis-12-Octadecadienoic acid;cis-D9,12-Octadecadienoic acid; |
CAS: | 60-33-3 |
EINECS: | 200-470-9 |
Molecular Formula: | C18H32O2 |
Molecular Weight: | 280.45 |
InChI: | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9- |
Molecular Structure: |
 |
Properties |
Density: | 0.902 |
Stability: | Stability Stable, but air and light sensitive. Combustible. Incompatible with strong oxidizing agents. |
Refractive index: | 1.4687-1.4707 |
Water Solubility: | INSOLUBLE |
Solubility: | INSOLUBLE |
Appearance: | colourless or light yellow liquid |
Specification: | Liquid at room temperature, colorless Safety Statements:26-24/25-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
Report: |
Reported in EPA TSCA Inventory.
|
Storage Temperature: | 2-8°C |
Sensitive: | Air Sensitive |
Color: | Colorless oil Colorless to straw-colored liquid |
Safety Data |
|
 |