| Identification | |
| Name: | Boron,trichloro(N,N-dimethylmethanamine)-, (T-4)- |
| Synonyms: | Methanamine,N,N-dimethyl-, compd. with trichloroborane (1:1); Trimethylamine, compd. withBCl3 (6CI,7CI); Trimethylamine, compd. with boron chloride (BCl3) (1:1) (8CI);Borane, trichloro-, compd. with N,N-dimethylmethanamine (1:1); Boron chloride(BCl3), compd. with trimethylamine (1:1) (8CI); Boron trichloride compound withtrimethylamine (1:1); Trimethylamine compd. with boron trichloride (1:1);Trimethylamine compound with trichloroborane (1:1);Trimethylamine-trichloroborane (1:1) adduct |
| CAS: | 1516-55-8 |
| EINECS: | 216-166-4 |
| Molecular Formula: | C3H9 B Cl3 N |
| Molecular Weight: | 176.28026 |
| InChI: | InChI=1/C3H9N.B.3ClH/c1-4(2)3;;;;/h1-3H3;;3*1H/q;+3;;;/p-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | 2.8°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
