| Identification | |
| Name: | 3-Thiophenepropanoicacid, a-amino-, hydrochloride (1:1), (aR)- |
| Synonyms: | 3-Thiophenepropanoicacid, a-amino-, hydrochloride, (R)-(9CI); (R)-3-(3-Thienyl)alanine hydrochloride |
| CAS: | 152612-26-5 |
| Molecular Formula: | C7H9 N O2 S . Cl H |
| Molecular Weight: | 171.22 |
| InChI: | InChI=1/C7H9NO2S/c8-6(7(9)10)3-5-1-2-11-4-5/h1-2,4,6H,3,8H2,(H,9,10)/t6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 147.5°C |
| Boiling Point: | 320.3°Cat760mmHg |
| Density: | 1.349g/cm3 |
| Refractive index: | 1.607 |
| Specification: |
3-Thiophenepropanoicacid, a-amino-, hydrochloride (1:1), (aR)- , its cas register number is 152612-26-5. It also can be called (2R)-2-Amino-3-(3-thienyl)propanoic acid ; 3-(3-Thienyl)-D-Alanine ; 3-Thiophen-3-yl-D-alanin . 3-Thiophenepropanoicacid, a-amino-, hydrochloride (1:1), (aR)- (CAS NO.152612-26-5) is irritating to eyes, respiratory system and skin. |
| Flash Point: | 147.5°C |
| Storage Temperature: | Store at RT. |
| Safety Data | |
 |
|
