| Identification | |
| Name: | 3-Thiophenepropanoicacid, a-amino-, (aS)- |
| Synonyms: | 3-Thiophenepropanoicacid, a-amino-, (S)-;3-(3-Thienyl)-L-alanine; b-(3-Thienyl)-L-alanine |
| CAS: | 3685-51-6 |
| Molecular Formula: | C7H9 N O2 S |
| Molecular Weight: | 171.22 |
| InChI: | InChI=1/C7H9NO2S/c1-5(7(9)10)8-6-2-3-11-4-6/h2-5,8H,1H3,(H,9,10)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 147.5°C |
| Boiling Point: | 320.3°Cat760mmHg |
| Density: | 1.349g/cm3 |
| Refractive index: | 1.631 |
| Specification: |
3-Thiophenepropanoicacid, a-amino-, (aS)- , its cas register number is 3685-51-6. It also can be called (2S)-2-Amino-3-(3-thienyl)propanoic acid ; 3-Thiophen-3-yl-L-alanin ; Alanine, 3-(3-thienyl)-, DL- and so on. 3-Thiophenepropanoicacid, a-amino-, (aS)- (CAS NO.3685-51-6) is irritating to eyes, respiratory system and skin. |
| Flash Point: | 147.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
