| Identification |
| Name: | 3-Chlorobenzyl cyanide |
| Synonyms: | (3-Chlorophenyl)acetonitrile; Benzeneacetonitrile, 3-chloro-; 3-Cyanobenzylchloride; m-Chlorobenzylcyanide; m-cyanobenzyl chloride |
| CAS: | 1529-41-5 |
| EINECS: | 216-213-9 |
| Molecular Formula: | C8H6ClN |
| Molecular Weight: | 151.59 |
| InChI: | InChI=1/C8H6ClN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3276 6.1/PG 1 |
| Flash Point: | 276-278 oC |
| Density: | 1.19 |
| Stability: | Stable. Incompatible with strong acids, strong bases, strong oxidizing agents, strong reducing agents. |
| Refractive index: | 1.5417-1.5437 |
| Solubility: | Insoluble |
| Appearance: | Clear colorless to faint yellow liquid. |
| Packinggroup: | II |
| Flash Point: | 276-278 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
