| Identification |
| Name: | 2H-1-Benzopyran-3,5,7-triol,2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R,3S)- |
| Synonyms: | 2H-1-Benzopyran-3,5,7-triol,2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R-trans)-;(+)-(2R:3S)-5,7,3',4'-Tetrahydroxyflavan-3-ol;(+)-Catechin;(+)-Cianidanol;Catechinic acid;Catergen;Cyanidanol;D-(+)-Catechin;D-Catechol;NSC 2819;Teafuran 30A; |
| CAS: | 154-23-4 |
| EINECS: | 205-825-1 |
| Molecular Formula: | C15H14O6 |
| Molecular Weight: | 290.27 |
| InChI: | InChI=1/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 175-177 °C (anhydrous)(lit.) |
| Flash Point: | 334.3 |
| Boiling Point: | 629 |
| Density: | 1.593 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.741 |
| Solubility: | Slightly soluble |
| Appearance: | Green needles. |
| Flash Point: | 334.3 |
| Storage Temperature: | 2-8°C |
| Usage: | Substance is used in dyeing and tanning. |
| Safety Data |
| |
 |
