| Identification | |
| Name: | 2H-1-Benzopyran-3,5,7-triol,2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R,3S)-rel- |
| CAS: | 7295-85-4 |
| EINECS: | 230-731-2 |
| Molecular Formula: | C15H14 O6 |
| Molecular Weight: | 290.26806 |
| InChI: | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Water Solubility: | Soluble in methanol. |
| Solubility: | Soluble in methanol. |
| Appearance: | White to yellow powder |
| Specification: |
2H-1-Benzopyran-3,5,7-triol,2-(3,4-dihydroxyphenyl)-3,4-dihydro-, (2R,3S)-rel- , with CAS number of 7295-85-4, can be called (+/-)-3,3',4',5,7-Flavanpentol ; 3,3',4',5,7-flavanpentol ; (+/-)-catechin ; catechin;catechin, dl- ; catechins ; catechu ; dl-catechin . |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
