| Identification | |
| Name: | Gold,chloro(triethylphosphine)- |
| Synonyms: | (Triethylphosphine)goldchloride; Chloro(triethylphosphine)gold; NSC 313981; SKF 36914;Triethylphosphine gold(I) chloride; Triethylphosphine-gold chloride complex;Triethylphosphineaurous chloride |
| CAS: | 15529-90-5 |
| EINECS: | 239-572-3 |
| Molecular Formula: | C6H15 Au Cl P |
| Molecular Weight: | 350.60 |
| InChI: | InChI=1S/C6H15P.Au.ClH/c1-4-7(5-2)6-3;;/h4-6H2,1-3H3;;1H/q;+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 84-86 °C(lit.) |
| Flash Point: | 27.2°C |
| Boiling Point: | 210 °C0.03 mm Hg(lit.) |
| Density: | g/cm3 |
| Specification: |
Chloro(triethylphosphine)gold , its cas register number is 15529-90-5. It also can be called Triethylphosphineaurous chloride ; and Triethyl phosphine gold . Its classification code are Mutation data and Reproductive Effect. |
| Packinggroup: | III |
| Flash Point: | 27.2°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
