Identification |
Name: | Benzamide,4-[(R)-[(2S,5R)-2,5-dimethyl-4-(2-propen-1-yl)-1-piperazinyl](3-methoxyphenyl)methyl]-N,N-diethyl- |
Synonyms: | Benzamide,4-[(R)-[(2S,5R)-2,5-dimethyl-4-(2-propenyl)-1-piperazinyl](3-methoxyphenyl)methyl]-N,N-diethyl-(9CI); Benzamide,4-[[2,5-dimethyl-4-(2-propenyl)-1-piperazinyl](3-methoxyphenyl)methyl]-N,N-diethyl-,[2S-[1(S*),2a,5b]]-; NIH 10815; SNC 80 |
CAS: | 156727-74-1 |
Molecular Formula: | C28H39 N3 O2 |
Molecular Weight: | 449.63 |
InChI: | InChI=1/C28H39N3O2/c1-7-17-30-19-22(5)31(20-21(30)4)27(25-11-10-12-26(18-25)33-6)23-13-15-24(16-14-23)28(32)29(8-2)9-3/h7,10-16,18,21-22,27H,1,8-9,17,19-20H2,2-6H3/t21-,22+,27-/m1/s1 |
Molecular Structure: |
methyl]-N,N-die...](https://img1.guidechem.com/chem/e/dict/32/156727-74-1.jpg) |
Properties |
Flash Point: | 295.4°C |
Boiling Point: | 564.8°Cat760mmHg |
Density: | 1.04g/cm3 |
Refractive index: | 1.544 |
Biological Activity: | A highly selective and potent non-peptide δ -opioid agonist, 2000-fold selective over μ -opioid receptors. |
Flash Point: | 295.4°C |
Color: | off-white |
Usage: | A highly selective and potent non-peptide -agonist, 2000-fold selective over u-receptors |
Safety Data |
|
 |