Identification |
Name: | Benzamide,4-[(R)-[(2S,5R)-2,5-dimethyl-4-propyl-1-piperazinyl](3-methoxyphenyl)methyl]-N,N-diethyl- |
Synonyms: | Benzamide,4-[(2,5-dimethyl-4-propyl-1-piperazinyl)(3-methoxyphenyl)methyl]-N,N-diethyl-,[2S-[1(S*),2a,5b]]-; SNC 121 |
CAS: | 159860-31-8 |
Molecular Formula: | C28H41 N3 O2 |
Molecular Weight: | 451.64 |
InChI: | InChI=1/C28H41N3O2/c1-7-17-30-19-22(5)31(20-21(30)4)27(25-11-10-12-26(18-25)33-6)23-13-15-24(16-14-23)28(32)29(8-2)9-3/h10-16,18,21-22,27H,7-9,17,19-20H2,1-6H3/t21-,22+,27-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 296.5°C |
Boiling Point: | 566.6°Cat760mmHg |
Density: | 1.033g/cm3 |
Refractive index: | 1.538 |
Biological Activity: | Saturated analog of the potent and selective δ opioid receptor agonist SNC 80 ((+)-4-[(aR)-a-((2S,5R)-4-Allyl-2,5-dimethyl-1-piperazinyl)-3-methoxybenzyl]-N,N-diethylbenzamide ), with a similar binding profile to the parent compound. |
Flash Point: | 296.5°C |
Safety Data |
|
|