| Identification | |
| Name: | Ethyl isonicotinate |
| Synonyms: | gamma-Pyridinecarboxylic acid ethyl ester;4-Picolinic acid ethyl ester or ethyl isonicotinate;4-Carboethoxypyridine;Isonicotinic acid ethyl ester; |
| CAS: | 1570-45-2 |
| EINECS: | 216-379-2 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-2-11-8(10)7-3-5-9-6-4-7/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 23 °C |
| Density: | 1.009 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4999-1.5019 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | clear colorless to light brown liquid |
| Specification: |
Ethyl isonicotinate (CAS NO.1570-45-2), its Synonyms are 4-Carbethoxypyridine ; 4-Carboethoxypyridine ; 4-Pyridinecarboxylic acid, ethyl ester ; Ethyl 4-pyridinecarboxylate ; Isonicotinic acid ethyl ester ; gamma-Pyridinecarboxylic acid ethyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
