| Identification | |
| Name: | CYCLOHEXYLAMMONIUM STEARATE |
| Synonyms: | cyclohexylammonium stearate |
| CAS: | 15860-21-6 |
| EINECS: | 239-984-3 |
| Molecular Formula: | C18H36O2 . C6H13N |
| Molecular Weight: | 383.74 |
| InChI: | InChI=1S/C18H36O2.C6H13N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-6-4-2-1-3-5-6/h2-17H2,1H3,(H,19,20);6H,1-5,7H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Cyclohexylammonium stearate ,its CAS NO. is 15860-21-6,the synonyms is Cyclohexylamine stearite ; EINECS 239-984-3 ; Stearic acid, cyclohexylamine salt (6CI) ; Cyclohexylammonium stearate ; Octadecanoic acid, compd. with cyclohexanamine (1:1) (9CI) ; Stearic acid, compd. with cyclohexylamine (1:1) . |
| Flash Point: | 162.4°C |
| Safety Data | |
 |
|
